Receptor
PDB id Resolution Class Description Source Keywords
1bn3 2.2 Å EC: 4.2.1.1 CARBONIC ANHYDRASE II INHIBITOR HOMO SAPIENS CO2 HYDRATION ZINC ENZYME LYASE
Ref.: STRUCTURAL ANALYSIS OF INHIBITOR BINDING TO HUMAN CARBONIC ANHYDRASE II. PROTEIN SCI. V. 7 2483 1998
Ligand Information
Ligand Validity Binding Data Ligand Warnings Chemaxon Viewer Molecular Weight (Da) Formula SMILES
AL6 Valid Kd = 0.13 nM none 372.44
C13 H12 N2 O5 S3
COc1cccc(c1)N2C=Cc3cc(sc3S2(=O)=O)S(=O)(=O)N
HG Invalid - none 200.59
Hg
[Hg+2]
ZN Part of Protein - none 65.409
Zn
[Zn+2]
90% Homology Family

The Class containing this family consists of a total of 11 families.

Leader:    1IF7     CARBONIC ANHYDRASE II COMPLEXED WITH (R)-N-(3-INDOL-1-YL-2- METHYL-PROPYL)-4-SULFAMOYL-BENZAMIDE
No: PDB id Binding Data Representative ligand
1 3K34 - SUA
2 2H15 Ki = 2135 nM B19
3 3T82 Ki = 307 nM SG4
4 1KWR ic50 = 0.25 uM SG2
5 1OQ5 ic50 = 21 nM CEL
6 1IF8 Kd = 230 pM SBS
7 2HL4 Ki = 23 nM BO1
8 2OSM ic50 = 1.05 uM HTS
9 3P58 Ki = 25.4 nM P58
10 1G53 Kd = 0.91 nM F6B
11 3BL0 Ki = 121 nM BL0
12 2QOA Ki = 52 nM MAJ
13 1I9L Kd = 3.3 nM INV
14 3SAX Kd = 0.14 uM E50
15 1BCD Kd = 2 nM FMS
16 3VBD Ki = 8.6 nM 0FZ
17 3M5E Kd = 0.043 uM JDR
18 3RZ7 Kd = 1.1 nM RZ7
19 3P5A Ki = 0.95 nM IT2
20 3MHL Kd = 0.056 uM J71
21 2AW1 Ki = 43 nM COX
22 2FNN Ki = 200 mM 4MZ
23 3P5L Ki = 40.8 nM IT5
24 2WD3 ic50 = 86 nM MS4
25 2POU Ki = 38 nM I7A
26 4E3F Ki = 3 mM GRE
27 3NB5 Ki = 18 nM R21
28 2HOC Ki = 0.3 nM 1CN
29 1I9N Kd = 2.2 nM IOA
30 3DD8 Ki = 14 nM 2C7
31 3MHC Ki = 11 nM ARZ
32 2WEG Kd = 314 nM FBV
33 3RZ0 Kd = 28 nM RZ0
34 1CNY Kd = 14 nM EG3
35 3MMF Ki = 37 nM D9H
36 3M96 Kd = 0.06 uM E38
37 3SAP Kd = 0.014 uM E2I
38 2FOV Kd = 28 nM B30
39 2X7U Ki = 5340 nM WZA
40 2NNS Kd = 0.9 uM M25
41 2GD8 ic50 = 379 nM PO1
42 1BNV Kd = 1.7 nM AL7
43 1I9Q Kd = 3.9 nM IOF
44 2Q1Q Ki = 7 nM OSP
45 3FFP Ki = 72.5 nM LC1
46 1G0E - 4MZ
47 3R17 Ki = 390 nM 5UM
48 2OSF ic50 ~ 148 uM TH0
49 2HD6 Ki = 16 nM BOS
50 2QO8 Ki = 3.4 nM 3CC
51 1I91 ic50 = 1.15 nM INQ
52 1BN1 Kd = 0.46 nM AL5
53 1G48 Kd = 3.9 nM F6B
54 1G45 Kd = 2.3 nM FSB
55 1AM6 ic50 = 47 uM HAE
56 2NNO Kd = 0.4 uM M28
57 1OKL Kd = 0.93 uM MNS
58 3CA2 - AMS
59 3OY0 Ki = 10.1 nM OY0
60 2FOS Kd = 27 nM B17
61 2EZ7 Kd = 43.5 uM DHI
62 3MZC Ki = 226 nM S6I
63 3M2N - J74
64 3OYS Ki = 9 nM OYS
65 1IF7 Kd = 30 pM SBR
66 3RYZ Kd = 2.4 nM RYZ
67 3DCW Ki < 1 nM EZL
68 3S8X Kd = 0.07 uM E59
69 3C7P ic50 = 0.1 nM POF
70 3K7K Kd ~ 8.86 nM KCS
71 3T83 Ki = 105 nM SG5
72 3BL1 Ki = 2520 nM BL1
73 3MHO Kd = 0.32 uM J43
74 3DAZ Ki = 11.8 nM MZM
75 3K2F Ki = 63 nM NKX
76 2WEO Kd = 118 nM FBW
77 1G54 Kd = 1.5 nM FFB
78 3PO6 - DT9
79 3V7X Ki = 2.7 nM D7A
80 2Q38 Ki = 5950 nM LSA
81 3IBU Ki = 0.7 nM O48
82 1BNT Kd = 0.16 nM AL2
83 3HS4 Ki = 10 nM AZM
84 2HKK Ka = 96 M^-1 ALE
85 3DCS Ki = 11.4 nM MZM
86 2NNG Kd = 4.4 uM ZYX
87 3RYV Kd = 86 nM RYV
88 2WEJ Kd = 839 nM FB2
89 3F8E Ki = 59 nM TE1
90 3MYQ Kd = 0.03 uM E27
91 3DD0 Ki < 1 nM EZL
92 3ML2 Ki = 9.1 nM SU0
93 3CYU Kd = 60 nM 0CR
94 3V5G Ki = 74 nM 0F3
95 1EOU ic50 = 36 nM SMS
96 1BN4 Kd = 0.49 nM AL9
97 1IF4 - FBS
98 1BNW Kd = 0.83 nM TPD
99 2EU3 - FF3
100 2QP6 Ki = 58.9 nM MB1
101 1G4O Kd = 5.6 nM BSB
102 3RZ8 Kd = 6.7 nM RZ8
103 3KIG ic50 = 245 nM DA4
104 3EFT Ki = 12 nM 3BS
105 3EFI - TRP
106 3N0N Ki = 50 nM P9B
107 1CIN Ki = 1.88 nM MTS
108 2X7T Ki = 232 nM WZB
109 3T5Z Ki = 8.96 uM B09
110 4FIK - TH7
111 4E3D Ki = 5 mM GTQ
112 2FMZ Ki = 35 nM DPN
113 1G46 Kd = 1.6 nM F2B
114 3IBL Ki = 14.6 nM O59
115 3IEO Ki = 331 nM AMJ
116 3F4X Ki = 138 nM KLT
117 3T5U Ki = 5.47 uM A09
118 1BNU Kd = 0.2 nM AL3
119 1OKN Kd = 2.3 nM STB
120 1IF6 - FBU
121 2O4Z Ki = 566 nM HSW
122 3T84 Ki = 106 nM SG6
123 3DBU Ki = 8.8 nM D8W
124 2WD2 - MS5
125 1CRA - TRI
126 1I9P Kd = 3.9 nM IOE
127 3N2P Ki = 15 nM AYX
128 3M40 Kd = 0.17 uM J45
129 2FOU Kd = 80 nM B22
130 1OKM - SAB
131 3RZ5 Kd = 13 nM RZ5
132 3N4B Ki = 96 nM WWZ
133 3M1K Ki = 4.1 uM BEW
134 1CIM Ki = 1.52 nM PTS
135 3HKN Ki = 4.51 uM MFS
136 1BN3 Kd = 0.13 nM AL6
137 2GEH Ki = 28 uM NHY
138 4E49 Ki = 7.7 uM RCO
139 3M3X Kd = 0.15 uM JS7
140 3B4F Ki = 7.2 nM TUO
141 4E3G Ki = 8 mM PHB
142 3MNU Ki = 48 nM BON
143 2ABE Ki = 113 uM HIS
144 3RYY Kd = 38 nM RYY
145 3SBI Kd = 0.017 uM E90
146 1BNQ Kd = 0.32 nM AL4
147 1XPZ Kd = 84 nM 4TZ
148 3RZ1 Kd = 1.8 nM RZ1
149 1YDB Kd = 5.8 nM AZM
150 2EU2 - 5DS
151 1MOO - 4MZ
152 2NNV Kd = 0.03 uM M29
153 3DC3 Ki = 4.9 nM AZM
154 3MNA Ki = 41 nM DWH
155 1CNW Kd = 19 nM EG1
156 1G1D Kd = 0.36 nM FSB
157 3N3J Ki = 3.3 nM WWV
158 3CAJ Ki = 8 nM EZL
159 2HNC Ki = 60 nM 1SA
160 3NI5 Ki = 28 nM C1H
161 3S9T Kd = 0.22 uM E49
162 3SBH Kd = 0.033 uM E65
163 3D9Z Ki = 2 nM D9Z
164 3P4V Ki = 8 uM PMX
165 1G52 Kd = 0.29 nM F2B
166 3IBI Ki = 2.6 nM BOW
167 2H4N Ki = 2 nM AZM
168 1I9O Kd = 3.8 nM IOC
169 1YDD Kd = 86 nM AZM
170 2POV Ki = 75 nM I7B
171 1G4J Kd = 2 nM FFB
172 3D8W Ki = 7 nM D8W
173 2WEH Kd = 1125 nM FB1
174 1ZSB Kd = 250 mM AZM
175 3OYQ Ki = 10.3 nM OYQ
176 3T85 Ki = 11.3 nM SG7
177 3M67 Kd = 0.18 uM E36
178 1IF5 - FBT
179 1I9M Kd = 3.3 nM INW
180 2X7S Ki = 1660 nM WZC
181 3IBN Ki = 24.5 nM O60
182 2FMG - PHE
183 1TTM Kd ~ 45 nM 667
184 3MHM Kd = 0.1 uM J75
185 2POW Ki = 63 nM I7C
186 1AVN Kd = 0.125 mM HSM
187 1I90 ic50 = 1.28 nM INM
188 1LUG - SUA
189 4E4A Ki = 9 mM JKE
190 1ZE8 Ki = 21 nM PIU
191 4E3H Ki = 90 nM HQE
192 1I8Z ic50 = 1.27 nM INL
193 1BNN Kd = 0.1 nM AL1
194 1XQ0 Kd = 454 nM 4TR
195 2Q1B Ki = 5950 nM LSA
196 3BET ic50 = 1.5 uM CTF
197 2F14 Ki = 45 nM FL1
198 3R16 Ki = 50 nM 5UN
199 1CIL Ki = 0.372 nM ETS
200 3MHI Kd = 0.2 uM J90
201 3DCC Ki = 1.1 nM D9Z
202 1YDA Kd = 280 nM AZM
203 3IGP ic50 = 94.5 nM DT7
204 3RYJ Kd = 16 nM RYJ
205 1CNX Kd = 43 nM EG2
206 2FOQ Kd = 235 nM B15
207 3RYX Kd = 7.3 nM RYX
208 1IF9 - SBB
More Information
External References
PDB
Pubmed
Biounit Downloads
This PDB
This Family
This Class
Comma Separated Files
This PDB
This Family
This Class
Download BindingMOAD
View in 3D viewer
Show:
Background:
Molecular Surface:
Left mouse click:
Jmol Command:
Jmol viewer:
- Jmol Mouse manual
- Jmol: an open-source Java viewer
for chemical structures in 3D.
- For Jmol Menu: Right click on the viewer.
- Note: Accept the security warning to view.